C17H15N3O2 — CID 75407034
(4Z)-2-(2,3-dihydro-1H-inden-5-yl)-4-[(1-methylpyrazol-4-yl)methylidene]-1,3-oxazol-5-one (PubChem CID 75407034) has the molecular formula C17H15N3O2 and a molecular weight of 293.33 g/mol. Its IUPAC name is (4Z)-2-(2,3-dihydro-1H-inden-5-yl)-4-[(1-methylpyrazol-4-yl)methylidene]-1,3-oxazol-5-one.
| Compound Name | (4Z)-2-(2,3-dihydro-1H-inden-5-yl)-4-[(1-methylpyrazol-4-yl)methylidene]-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 75407034 |
| Molecular Formula | C17H15N3O2 |
| Molecular Weight | 293.33 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | (4Z)-2-(2,3-dihydro-1H-inden-5-yl)-4-[(1-methylpyrazol-4-yl)methylidene]-1,3-oxazol-5-one |
| SMILES | Cn1cc(/C=C2\N=C(c3ccc4c(c3)CCC4)OC2=O)cn1 |
| InChI | InChI=1S/C17H15N3O2/c1-20-10-11(9-18-20)7-15-17(21)22-16(19-15)14-6-5-12-3-2-4-13(12)8-14/h5-10H,2-4H2,1H3/b15-7- |
| InChIKey | KOBVFPRHDKNBTH-CHHVJCJISA-N |
| XLogP | 2.25 |
| TPSA | 56.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.33 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|