C20H29N3O2 — CID 75407410
(E)-4,4-dimethyl-N-[2-(4-methyl-1,4-diazepane-1-carbonyl)phenyl]pent-2-enamide (PubChem CID 75407410) has the molecular formula C20H29N3O2 and a molecular weight of 343.47 g/mol. Its IUPAC name is (E)-4,4-dimethyl-N-[2-(4-methyl-1,4-diazepane-1-carbonyl)phenyl]pent-2-enamide.
| Compound Name | (E)-4,4-dimethyl-N-[2-(4-methyl-1,4-diazepane-1-carbonyl)phenyl]pent-2-enamide |
|---|---|
| PubChem CID | 75407410 |
| Molecular Formula | C20H29N3O2 |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.23 |
| IUPAC Name | (E)-4,4-dimethyl-N-[2-(4-methyl-1,4-diazepane-1-carbonyl)phenyl]pent-2-enamide |
| SMILES | CN1CCCN(C(=O)c2ccccc2NC(=O)/C=C/C(C)(C)C)CC1 |
| InChI | InChI=1S/C20H29N3O2/c1-20(2,3)11-10-18(24)21-17-9-6-5-8-16(17)19(25)23-13-7-12-22(4)14-15-23/h5-6,8-11H,7,12-15H2,1-4H3,(H,21,24)/b11-10+ |
| InChIKey | AVWFGVHVWSAIQB-ZHACJKMWSA-N |
| XLogP | 3.01 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|