C31H27N5O6S2 — CID 75409737
(2E)-2-cyano-2-[(5Z)-3-(4-methylphenyl)-5-[(4-nitrophenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]-N-(3-piperidin-1-ylsulfonylphenyl)acetamide (PubChem CID 75409737) has the molecular formula C31H27N5O6S2 and a molecular weight of 629.72 g/mol. Its IUPAC name is (2E)-2-cyano-2-[(5Z)-3-(4-methylphenyl)-5-[(4-nitrophenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]-N-(3-piperidin-1-ylsulfonylphenyl)acetamide.
| Compound Name | (2E)-2-cyano-2-[(5Z)-3-(4-methylphenyl)-5-[(4-nitrophenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]-N-(3-piperidin-1-ylsulfonylphenyl)acetamide |
|---|---|
| PubChem CID | 75409737 |
| Molecular Formula | C31H27N5O6S2 |
| Molecular Weight | 629.72 g/mol |
| Exact Mass | 629.14 |
| IUPAC Name | (2E)-2-cyano-2-[(5Z)-3-(4-methylphenyl)-5-[(4-nitrophenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]-N-(3-piperidin-1-ylsulfonylphenyl)acetamide |
| SMILES | Cc1ccc(-n2c(=O)/c(=C/c3ccc([N+](=O)[O-])cc3)s/c2=C(\C#N)C(=O)Nc2cccc(S(=O)(=O)N3CCCCC3)c2)cc1 |
| InChI | InChI=1S/C31H27N5O6S2/c1-21-8-12-24(13-9-21)35-30(38)28(18-22-10-14-25(15-11-22)36(39)40)43-31(35)27(20-32)29(37)33-23-6-5-7-26(19-23)44(41,42)34-16-3-2-4-17-34/h5-15,18-19H,2-4,16-17H2,1H3,(H,33,37)/b28-18-,31-27+ |
| InChIKey | HWTAIDRVADQURK-VNLDAXEMSA-N |
| XLogP | 3.43 |
| TPSA | 155.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.72 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|