C12H17N3O2S2 — CID 75414072
2-(2,4-dimethyl-1,3-thiazol-5-yl)-5-(2-propan-2-yloxyethylsulfanyl)-1,3,4-oxadiazole (PubChem CID 75414072) has the molecular formula C12H17N3O2S2 and a molecular weight of 299.42 g/mol. Its IUPAC name is 2-(2,4-dimethyl-1,3-thiazol-5-yl)-5-(2-propan-2-yloxyethylsulfanyl)-1,3,4-oxadiazole.
| Compound Name | 2-(2,4-dimethyl-1,3-thiazol-5-yl)-5-(2-propan-2-yloxyethylsulfanyl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 75414072 |
| Molecular Formula | C12H17N3O2S2 |
| Molecular Weight | 299.42 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | 2-(2,4-dimethyl-1,3-thiazol-5-yl)-5-(2-propan-2-yloxyethylsulfanyl)-1,3,4-oxadiazole |
| SMILES | Cc1nc(C)c(-c2nnc(SCCOC(C)C)o2)s1 |
| InChI | InChI=1S/C12H17N3O2S2/c1-7(2)16-5-6-18-12-15-14-11(17-12)10-8(3)13-9(4)19-10/h7H,5-6H2,1-4H3 |
| InChIKey | BJSDTHVDFZCQDJ-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 61.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.42 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|