C15H14ClN3O2S2 — CID 46531368
2-[2-(4-chlorophenoxy)ethylsulfanyl]-5-(2,4-dimethyl-1,3-thiazol-5-yl)-1,3,4-oxadiazole (PubChem CID 46531368) has the molecular formula C15H14ClN3O2S2 and a molecular weight of 367.88 g/mol. Its IUPAC name is 2-[2-(4-chlorophenoxy)ethylsulfanyl]-5-(2,4-dimethyl-1,3-thiazol-5-yl)-1,3,4-oxadiazole.
| Compound Name | 2-[2-(4-chlorophenoxy)ethylsulfanyl]-5-(2,4-dimethyl-1,3-thiazol-5-yl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 46531368 |
| Molecular Formula | C15H14ClN3O2S2 |
| Molecular Weight | 367.88 g/mol |
| Exact Mass | 367.02 |
| IUPAC Name | 2-[2-(4-chlorophenoxy)ethylsulfanyl]-5-(2,4-dimethyl-1,3-thiazol-5-yl)-1,3,4-oxadiazole |
| SMILES | Cc1nc(C)c(-c2nnc(SCCOc3ccc(Cl)cc3)o2)s1 |
| InChI | InChI=1S/C15H14ClN3O2S2/c1-9-13(23-10(2)17-9)14-18-19-15(21-14)22-8-7-20-12-5-3-11(16)4-6-12/h3-6H,7-8H2,1-2H3 |
| InChIKey | SCVTXYQUGUHPMF-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 61.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.88 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|