C17H15FN2O3S — CID 75424604
methyl 3-(6-fluoro-1H-indol-3-yl)-2-(thiophene-3-carbonylamino)propanoate (PubChem CID 75424604) has the molecular formula C17H15FN2O3S and a molecular weight of 346.38 g/mol. Its IUPAC name is methyl 3-(6-fluoro-1H-indol-3-yl)-2-(thiophene-3-carbonylamino)propanoate.
| Compound Name | methyl 3-(6-fluoro-1H-indol-3-yl)-2-(thiophene-3-carbonylamino)propanoate |
|---|---|
| PubChem CID | 75424604 |
| Molecular Formula | C17H15FN2O3S |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.08 |
| IUPAC Name | methyl 3-(6-fluoro-1H-indol-3-yl)-2-(thiophene-3-carbonylamino)propanoate |
| SMILES | COC(=O)C(Cc1c[nH]c2cc(F)ccc12)NC(=O)c1ccsc1 |
| InChI | InChI=1S/C17H15FN2O3S/c1-23-17(22)15(20-16(21)10-4-5-24-9-10)6-11-8-19-14-7-12(18)2-3-13(11)14/h2-5,7-9,15,19H,6H2,1H3,(H,20,21) |
| InChIKey | AXXLEADFGVTUPR-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |