C12H10FN3O3S — CID 75426013
4-fluoro-2-nitro-N-[2-(1,3-thiazol-4-yl)ethyl]benzamide (PubChem CID 75426013) has the molecular formula C12H10FN3O3S and a molecular weight of 295.29 g/mol. Its IUPAC name is 4-fluoro-2-nitro-N-[2-(1,3-thiazol-4-yl)ethyl]benzamide.
| Compound Name | 4-fluoro-2-nitro-N-[2-(1,3-thiazol-4-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 75426013 |
| Molecular Formula | C12H10FN3O3S |
| Molecular Weight | 295.29 g/mol |
| Exact Mass | 295.04 |
| IUPAC Name | 4-fluoro-2-nitro-N-[2-(1,3-thiazol-4-yl)ethyl]benzamide |
| SMILES | O=C(NCCc1cscn1)c1ccc(F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H10FN3O3S/c13-8-1-2-10(11(5-8)16(18)19)12(17)14-4-3-9-6-20-7-15-9/h1-2,5-7H,3-4H2,(H,14,17) |
| InChIKey | OWBYMVVLYNQMOI-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 85.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.29 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|