C19H24N4O4S — CID 75431270
5-methyl-3-[4-(2-methylimidazol-1-yl)butyl]-5-(4-methylsulfonylphenyl)imidazolidine-2,4-dione (PubChem CID 75431270) has the molecular formula C19H24N4O4S and a molecular weight of 404.49 g/mol. Its IUPAC name is 5-methyl-3-[4-(2-methylimidazol-1-yl)butyl]-5-(4-methylsulfonylphenyl)imidazolidine-2,4-dione.
| Compound Name | 5-methyl-3-[4-(2-methylimidazol-1-yl)butyl]-5-(4-methylsulfonylphenyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 75431270 |
| Molecular Formula | C19H24N4O4S |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | 5-methyl-3-[4-(2-methylimidazol-1-yl)butyl]-5-(4-methylsulfonylphenyl)imidazolidine-2,4-dione |
| SMILES | Cc1nccn1CCCCN1C(=O)NC(C)(c2ccc(S(C)(=O)=O)cc2)C1=O |
| InChI | InChI=1S/C19H24N4O4S/c1-14-20-10-13-22(14)11-4-5-12-23-17(24)19(2,21-18(23)25)15-6-8-16(9-7-15)28(3,26)27/h6-10,13H,4-5,11-12H2,1-3H3,(H,21,25) |
| InChIKey | ABNOTLCGJCKOEC-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 101.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|