C19H24N4O2 — CID 84593571
5-(2,4-dimethylphenyl)-5-methyl-3-[3-(2-methylimidazol-1-yl)propyl]imidazolidine-2,4-dione (PubChem CID 84593571) has the molecular formula C19H24N4O2 and a molecular weight of 340.43 g/mol. Its IUPAC name is 5-(2,4-dimethylphenyl)-5-methyl-3-[3-(2-methylimidazol-1-yl)propyl]imidazolidine-2,4-dione.
| Compound Name | 5-(2,4-dimethylphenyl)-5-methyl-3-[3-(2-methylimidazol-1-yl)propyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 84593571 |
| Molecular Formula | C19H24N4O2 |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | 5-(2,4-dimethylphenyl)-5-methyl-3-[3-(2-methylimidazol-1-yl)propyl]imidazolidine-2,4-dione |
| SMILES | Cc1ccc(C2(C)NC(=O)N(CCCn3ccnc3C)C2=O)c(C)c1 |
| InChI | InChI=1S/C19H24N4O2/c1-13-6-7-16(14(2)12-13)19(4)17(24)23(18(25)21-19)10-5-9-22-11-8-20-15(22)3/h6-8,11-12H,5,9-10H2,1-4H3,(H,21,25) |
| InChIKey | DGCDUXNPHXGTRU-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|