C15H14N6O2S — CID 75431408
5-nitro-N-(1-thieno[2,3-d]pyrimidin-4-ylpyrrolidin-3-yl)pyridin-2-amine (PubChem CID 75431408) has the molecular formula C15H14N6O2S and a molecular weight of 342.38 g/mol. Its IUPAC name is 5-nitro-N-(1-thieno[2,3-d]pyrimidin-4-ylpyrrolidin-3-yl)pyridin-2-amine.
| Compound Name | 5-nitro-N-(1-thieno[2,3-d]pyrimidin-4-ylpyrrolidin-3-yl)pyridin-2-amine |
|---|---|
| PubChem CID | 75431408 |
| Molecular Formula | C15H14N6O2S |
| Molecular Weight | 342.38 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | 5-nitro-N-(1-thieno[2,3-d]pyrimidin-4-ylpyrrolidin-3-yl)pyridin-2-amine |
| SMILES | O=[N+]([O-])c1ccc(NC2CCN(c3ncnc4sccc34)C2)nc1 |
| InChI | InChI=1S/C15H14N6O2S/c22-21(23)11-1-2-13(16-7-11)19-10-3-5-20(8-10)14-12-4-6-24-15(12)18-9-17-14/h1-2,4,6-7,9-10H,3,5,8H2,(H,16,19) |
| InChIKey | JVGZCHCGXLWZLA-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 97.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.38 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|