C24H29N3O4 — CID 7543540
butyl 4-[[(3R)-1-(3,4-dimethylphenyl)-5-oxopyrrolidin-3-yl]carbamoylamino]benzoate (PubChem CID 7543540) has the molecular formula C24H29N3O4 and a molecular weight of 423.51 g/mol. Its IUPAC name is butyl 4-[[(3R)-1-(3,4-dimethylphenyl)-5-oxopyrrolidin-3-yl]carbamoylamino]benzoate.
| Compound Name | butyl 4-[[(3R)-1-(3,4-dimethylphenyl)-5-oxopyrrolidin-3-yl]carbamoylamino]benzoate |
|---|---|
| PubChem CID | 7543540 |
| Molecular Formula | C24H29N3O4 |
| Molecular Weight | 423.51 g/mol |
| Exact Mass | 423.22 |
| IUPAC Name | butyl 4-[[(3R)-1-(3,4-dimethylphenyl)-5-oxopyrrolidin-3-yl]carbamoylamino]benzoate |
| SMILES | CCCCOC(=O)c1ccc(NC(=O)N[C@@H]2CC(=O)N(c3ccc(C)c(C)c3)C2)cc1 |
| InChI | InChI=1S/C24H29N3O4/c1-4-5-12-31-23(29)18-7-9-19(10-8-18)25-24(30)26-20-14-22(28)27(15-20)21-11-6-16(2)17(3)13-21/h6-11,13,20H,4-5,12,14-15H2,1-3H3,(H2,25,26,30)/t20-/m1/s1 |
| InChIKey | WUTQWLFYQXUYRI-HXUWFJFHSA-N |
| XLogP | 4.19 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.51 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|