C16H16N4O2S — CID 75435793
N-(2-hydroxyethyl)-N-(pyridin-3-ylmethyl)-5-thiophen-2-yl-1H-pyrazole-3-carboxamide (PubChem CID 75435793) has the molecular formula C16H16N4O2S and a molecular weight of 328.40 g/mol. Its IUPAC name is N-(2-hydroxyethyl)-N-(pyridin-3-ylmethyl)-5-thiophen-2-yl-1H-pyrazole-3-carboxamide.
| Compound Name | N-(2-hydroxyethyl)-N-(pyridin-3-ylmethyl)-5-thiophen-2-yl-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 75435793 |
| Molecular Formula | C16H16N4O2S |
| Molecular Weight | 328.40 g/mol |
| Exact Mass | 328.10 |
| IUPAC Name | N-(2-hydroxyethyl)-N-(pyridin-3-ylmethyl)-5-thiophen-2-yl-1H-pyrazole-3-carboxamide |
| SMILES | O=C(c1cc(-c2cccs2)[nH]n1)N(CCO)Cc1cccnc1 |
| InChI | InChI=1S/C16H16N4O2S/c21-7-6-20(11-12-3-1-5-17-10-12)16(22)14-9-13(18-19-14)15-4-2-8-23-15/h1-5,8-10,21H,6-7,11H2,(H,18,19) |
| InChIKey | GURLFXUKGKPSJA-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 82.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.40 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |