C19H21N3O2 — CID 75436629
[3-(benzylamino)piperidin-1-yl]-(4H-furo[3,2-b]pyrrol-5-yl)methanone (PubChem CID 75436629) has the molecular formula C19H21N3O2 and a molecular weight of 323.40 g/mol. Its IUPAC name is [3-(benzylamino)piperidin-1-yl]-(4H-furo[3,2-b]pyrrol-5-yl)methanone.
| Compound Name | [3-(benzylamino)piperidin-1-yl]-(4H-furo[3,2-b]pyrrol-5-yl)methanone |
|---|---|
| PubChem CID | 75436629 |
| Molecular Formula | C19H21N3O2 |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | [3-(benzylamino)piperidin-1-yl]-(4H-furo[3,2-b]pyrrol-5-yl)methanone |
| SMILES | O=C(c1cc2occc2[nH]1)N1CCCC(NCc2ccccc2)C1 |
| InChI | InChI=1S/C19H21N3O2/c23-19(17-11-18-16(21-17)8-10-24-18)22-9-4-7-15(13-22)20-12-14-5-2-1-3-6-14/h1-3,5-6,8,10-11,15,20-21H,4,7,9,12-13H2 |
| InChIKey | XKYXYMIJBKSXAQ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |