C17H14N4O2S — CID 75437713
N-[3-(3-cyanopropoxy)-2-pyridinyl]-1,3-benzothiazole-2-carboxamide (PubChem CID 75437713) has the molecular formula C17H14N4O2S and a molecular weight of 338.39 g/mol. Its IUPAC name is N-[3-(3-cyanopropoxy)-2-pyridinyl]-1,3-benzothiazole-2-carboxamide.
| Compound Name | N-[3-(3-cyanopropoxy)-2-pyridinyl]-1,3-benzothiazole-2-carboxamide |
|---|---|
| PubChem CID | 75437713 |
| Molecular Formula | C17H14N4O2S |
| Molecular Weight | 338.39 g/mol |
| Exact Mass | 338.08 |
| IUPAC Name | N-[3-(3-cyanopropoxy)-2-pyridinyl]-1,3-benzothiazole-2-carboxamide |
| SMILES | N#CCCCOc1cccnc1NC(=O)c1nc2ccccc2s1 |
| InChI | InChI=1S/C17H14N4O2S/c18-9-3-4-11-23-13-7-5-10-19-15(13)21-16(22)17-20-12-6-1-2-8-14(12)24-17/h1-2,5-8,10H,3-4,11H2,(H,19,21,22) |
| InChIKey | NNYGNFXVGQGOPD-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 87.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.39 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|