C16H21FN4O3 — CID 75438655
2-fluoro-5-methoxy-4-nitro-N-[1-(1,3,5-trimethylpyrazol-4-yl)propan-2-yl]aniline (PubChem CID 75438655) has the molecular formula C16H21FN4O3 and a molecular weight of 336.37 g/mol. Its IUPAC name is 2-fluoro-5-methoxy-4-nitro-N-[1-(1,3,5-trimethylpyrazol-4-yl)propan-2-yl]aniline.
| Compound Name | 2-fluoro-5-methoxy-4-nitro-N-[1-(1,3,5-trimethylpyrazol-4-yl)propan-2-yl]aniline |
|---|---|
| PubChem CID | 75438655 |
| Molecular Formula | C16H21FN4O3 |
| Molecular Weight | 336.37 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | 2-fluoro-5-methoxy-4-nitro-N-[1-(1,3,5-trimethylpyrazol-4-yl)propan-2-yl]aniline |
| SMILES | COc1cc(NC(C)Cc2c(C)nn(C)c2C)c(F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H21FN4O3/c1-9(6-12-10(2)19-20(4)11(12)3)18-14-8-16(24-5)15(21(22)23)7-13(14)17/h7-9,18H,6H2,1-5H3 |
| InChIKey | RUGYQSINXRTGGP-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 82.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.37 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|