C17H21NO4 — CID 75440912
benzyl 3-(bicyclo[3.1.0]hexane-6-carbonylamino)-2-hydroxypropanoate (PubChem CID 75440912) has the molecular formula C17H21NO4 and a molecular weight of 303.36 g/mol. Its IUPAC name is benzyl 3-(bicyclo[3.1.0]hexane-6-carbonylamino)-2-hydroxypropanoate.
| Compound Name | benzyl 3-(bicyclo[3.1.0]hexane-6-carbonylamino)-2-hydroxypropanoate |
|---|---|
| PubChem CID | 75440912 |
| Molecular Formula | C17H21NO4 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | benzyl 3-(bicyclo[3.1.0]hexane-6-carbonylamino)-2-hydroxypropanoate |
| SMILES | O=C(OCc1ccccc1)C(O)CNC(=O)C1C2CCCC21 |
| InChI | InChI=1S/C17H21NO4/c19-14(17(21)22-10-11-5-2-1-3-6-11)9-18-16(20)15-12-7-4-8-13(12)15/h1-3,5-6,12-15,19H,4,7-10H2,(H,18,20) |
| InChIKey | FKWBRPPEODAQBR-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |