C17H14N6O2 — CID 75440945
N-[2-(3-ethynylanilino)-2-oxoethyl]-N-methyl-2H-triazolo[4,5-b]pyridine-6-carboxamide (PubChem CID 75440945) has the molecular formula C17H14N6O2 and a molecular weight of 334.34 g/mol. Its IUPAC name is N-[2-(3-ethynylanilino)-2-oxoethyl]-N-methyl-2H-triazolo[4,5-b]pyridine-6-carboxamide.
| Compound Name | N-[2-(3-ethynylanilino)-2-oxoethyl]-N-methyl-2H-triazolo[4,5-b]pyridine-6-carboxamide |
|---|---|
| PubChem CID | 75440945 |
| Molecular Formula | C17H14N6O2 |
| Molecular Weight | 334.34 g/mol |
| Exact Mass | 334.12 |
| IUPAC Name | N-[2-(3-ethynylanilino)-2-oxoethyl]-N-methyl-2H-triazolo[4,5-b]pyridine-6-carboxamide |
| SMILES | C#Cc1cccc(NC(=O)CN(C)C(=O)c2cnc3n[nH]nc3c2)c1 |
| InChI | InChI=1S/C17H14N6O2/c1-3-11-5-4-6-13(7-11)19-15(24)10-23(2)17(25)12-8-14-16(18-9-12)21-22-20-14/h1,4-9H,10H2,2H3,(H,19,24)(H,18,20,21,22) |
| InChIKey | QZOXVGBHSYGZCX-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 103.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.34 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|