C13H16F3NO5S — CID 75443991
ethyl 4-[methyl-(3,3,3-trifluoro-2-hydroxypropyl)sulfamoyl]benzoate (PubChem CID 75443991) has the molecular formula C13H16F3NO5S and a molecular weight of 355.33 g/mol. Its IUPAC name is ethyl 4-[methyl-(3,3,3-trifluoro-2-hydroxypropyl)sulfamoyl]benzoate.
| Compound Name | ethyl 4-[methyl-(3,3,3-trifluoro-2-hydroxypropyl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 75443991 |
| Molecular Formula | C13H16F3NO5S |
| Molecular Weight | 355.33 g/mol |
| Exact Mass | 355.07 |
| IUPAC Name | ethyl 4-[methyl-(3,3,3-trifluoro-2-hydroxypropyl)sulfamoyl]benzoate |
| SMILES | CCOC(=O)c1ccc(S(=O)(=O)N(C)CC(O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C13H16F3NO5S/c1-3-22-12(19)9-4-6-10(7-5-9)23(20,21)17(2)8-11(18)13(14,15)16/h4-7,11,18H,3,8H2,1-2H3 |
| InChIKey | GAEODWLIRXILOU-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.33 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |