C16H20N2O4S2 — CID 47959412
ethyl 4-[(2-ethyl-1,3-thiazol-4-yl)methyl-methylsulfamoyl]benzoate (PubChem CID 47959412) has the molecular formula C16H20N2O4S2 and a molecular weight of 368.48 g/mol. Its IUPAC name is ethyl 4-[(2-ethyl-1,3-thiazol-4-yl)methyl-methylsulfamoyl]benzoate.
| Compound Name | ethyl 4-[(2-ethyl-1,3-thiazol-4-yl)methyl-methylsulfamoyl]benzoate |
|---|---|
| PubChem CID | 47959412 |
| Molecular Formula | C16H20N2O4S2 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.09 |
| IUPAC Name | ethyl 4-[(2-ethyl-1,3-thiazol-4-yl)methyl-methylsulfamoyl]benzoate |
| SMILES | CCOC(=O)c1ccc(S(=O)(=O)N(C)Cc2csc(CC)n2)cc1 |
| InChI | InChI=1S/C16H20N2O4S2/c1-4-15-17-13(11-23-15)10-18(3)24(20,21)14-8-6-12(7-9-14)16(19)22-5-2/h6-9,11H,4-5,10H2,1-3H3 |
| InChIKey | RKLGCLWZGFMROF-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 76.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |