C23H31NO7S — CID 92529564
ethyl 4-[[(2S)-3,3-diethoxy-2-hydroxypropyl]-(4-methylphenyl)sulfonylamino]benzoate (PubChem CID 92529564) has the molecular formula C23H31NO7S and a molecular weight of 465.57 g/mol. Its IUPAC name is ethyl 4-[[(2S)-3,3-diethoxy-2-hydroxypropyl]-(4-methylphenyl)sulfonylamino]benzoate.
| Compound Name | ethyl 4-[[(2S)-3,3-diethoxy-2-hydroxypropyl]-(4-methylphenyl)sulfonylamino]benzoate |
|---|---|
| PubChem CID | 92529564 |
| Molecular Formula | C23H31NO7S |
| Molecular Weight | 465.57 g/mol |
| Exact Mass | 465.18 |
| IUPAC Name | ethyl 4-[[(2S)-3,3-diethoxy-2-hydroxypropyl]-(4-methylphenyl)sulfonylamino]benzoate |
| SMILES | CCOC(=O)c1ccc(N(C[C@H](O)C(OCC)OCC)S(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C23H31NO7S/c1-5-29-22(26)18-10-12-19(13-11-18)24(16-21(25)23(30-6-2)31-7-3)32(27,28)20-14-8-17(4)9-15-20/h8-15,21,23,25H,5-7,16H2,1-4H3/t21-/m0/s1 |
| InChIKey | AMCFRLYHGIADQW-NRFANRHFSA-N |
| XLogP | 3.13 |
| TPSA | 102.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.57 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|