About 3-chloro-N-(4-phenyl-1,3-thiazol-2-yl)benzamide
3-chloro-N-(4-phenyl-1,3-thiazol-2-yl)benzamide (PubChem CID 754492) has the molecular formula C16H11ClN2OS
and a molecular weight of 314.80 g/mol. Its IUPAC name is 3-chloro-N-(4-phenyl-1,3-thiazol-2-yl)benzamide.
Molecular Properties
| Compound Name | 3-chloro-N-(4-phenyl-1,3-thiazol-2-yl)benzamide |
| PubChem CID | 754492 |
| Molecular Formula | C16H11ClN2OS |
| Molecular Weight | 314.80 g/mol |
| Exact Mass | 314.03 |
| IUPAC Name | 3-chloro-N-(4-phenyl-1,3-thiazol-2-yl)benzamide |
| SMILES | O=C(Nc1nc(-c2ccccc2)cs1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C16H11ClN2OS/c17-13-8-4-7-12(9-13)15(20)19-16-18-14(10-21-16)11-5-2-1-3-6-11/h1-10H,(H,18,19,20) |
| InChIKey | OHXHEHNTSIBWMV-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.80 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-chloro-N-(4-phenyl-1,3-thiazol-2-yl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-N-(4-phenyl-1,3-thiazol-2-yl)benzamide?
The IUPAC name of 3-chloro-N-(4-phenyl-1,3-thiazol-2-yl)benzamide (CID 754492) is 3-chloro-N-(4-phenyl-1,3-thiazol-2-yl)benzamide.
What is the SMILES notation for 3-chloro-N-(4-phenyl-1,3-thiazol-2-yl)benzamide?
The canonical SMILES for 3-chloro-N-(4-phenyl-1,3-thiazol-2-yl)benzamide is O=C(Nc1nc(-c2ccccc2)cs1)c1cccc(Cl)c1.
What is the InChIKey of 3-chloro-N-(4-phenyl-1,3-thiazol-2-yl)benzamide?
The InChIKey is OHXHEHNTSIBWMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H11ClN2OS/c17-13-8-4-7-12(9-13)15(20)19-16-18-14(10-21-16)11-5-2-1-3-6-11/h1-10H,(H,18,19,20).
What are the key properties of 3-chloro-N-(4-phenyl-1,3-thiazol-2-yl)benzamide?
3-chloro-N-(4-phenyl-1,3-thiazol-2-yl)benzamide has a molecular weight of 314.80 g/mol, XLogP of 4.72, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-N-(4-phenyl-1,3-thiazol-2-yl)benzamide is sourced from PubChem (CID 754492), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).