C18H25N3O — CID 75452820
2-[(2-methyl-3-propan-2-ylquinolin-4-yl)amino]-N-propan-2-ylacetamide (PubChem CID 75452820) has the molecular formula C18H25N3O and a molecular weight of 299.42 g/mol. Its IUPAC name is 2-[(2-methyl-3-propan-2-ylquinolin-4-yl)amino]-N-propan-2-ylacetamide.
| Compound Name | 2-[(2-methyl-3-propan-2-ylquinolin-4-yl)amino]-N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 75452820 |
| Molecular Formula | C18H25N3O |
| Molecular Weight | 299.42 g/mol |
| Exact Mass | 299.20 |
| IUPAC Name | 2-[(2-methyl-3-propan-2-ylquinolin-4-yl)amino]-N-propan-2-ylacetamide |
| SMILES | Cc1nc2ccccc2c(NCC(=O)NC(C)C)c1C(C)C |
| InChI | InChI=1S/C18H25N3O/c1-11(2)17-13(5)21-15-9-7-6-8-14(15)18(17)19-10-16(22)20-12(3)4/h6-9,11-12H,10H2,1-5H3,(H,19,21)(H,20,22) |
| InChIKey | SDGXSMUAUXWGEI-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.42 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |