C13H14N4O2S — CID 75458416
1-(1-cyanocyclopentyl)-N-(5-cyano-2-pyridinyl)methanesulfonamide (PubChem CID 75458416) has the molecular formula C13H14N4O2S and a molecular weight of 290.35 g/mol. Its IUPAC name is 1-(1-cyanocyclopentyl)-N-(5-cyano-2-pyridinyl)methanesulfonamide.
| Compound Name | 1-(1-cyanocyclopentyl)-N-(5-cyano-2-pyridinyl)methanesulfonamide |
|---|---|
| PubChem CID | 75458416 |
| Molecular Formula | C13H14N4O2S |
| Molecular Weight | 290.35 g/mol |
| Exact Mass | 290.08 |
| IUPAC Name | 1-(1-cyanocyclopentyl)-N-(5-cyano-2-pyridinyl)methanesulfonamide |
| SMILES | N#Cc1ccc(NS(=O)(=O)CC2(C#N)CCCC2)nc1 |
| InChI | InChI=1S/C13H14N4O2S/c14-7-11-3-4-12(16-8-11)17-20(18,19)10-13(9-15)5-1-2-6-13/h3-4,8H,1-2,5-6,10H2,(H,16,17) |
| InChIKey | RNHJDDXQDGOINW-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 106.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.35 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |