C17H20ClN3O4S2 — CID 75458445
N-[(4-amino-2-chlorophenyl)methyl]-4-pyrrolidin-1-ylsulfonylbenzenesulfonamide (PubChem CID 75458445) has the molecular formula C17H20ClN3O4S2 and a molecular weight of 429.95 g/mol. Its IUPAC name is N-[(4-amino-2-chlorophenyl)methyl]-4-pyrrolidin-1-ylsulfonylbenzenesulfonamide.
| Compound Name | N-[(4-amino-2-chlorophenyl)methyl]-4-pyrrolidin-1-ylsulfonylbenzenesulfonamide |
|---|---|
| PubChem CID | 75458445 |
| Molecular Formula | C17H20ClN3O4S2 |
| Molecular Weight | 429.95 g/mol |
| Exact Mass | 429.06 |
| IUPAC Name | N-[(4-amino-2-chlorophenyl)methyl]-4-pyrrolidin-1-ylsulfonylbenzenesulfonamide |
| SMILES | Nc1ccc(CNS(=O)(=O)c2ccc(S(=O)(=O)N3CCCC3)cc2)c(Cl)c1 |
| InChI | InChI=1S/C17H20ClN3O4S2/c18-17-11-14(19)4-3-13(17)12-20-26(22,23)15-5-7-16(8-6-15)27(24,25)21-9-1-2-10-21/h3-8,11,20H,1-2,9-10,12,19H2 |
| InChIKey | DGPDQISAIVYQDV-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.95 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|