C17H24N2O4S — CID 75461843
N-cycloheptyl-N'-(5-methyl-2-methylsulfonylphenyl)oxamide (PubChem CID 75461843) has the molecular formula C17H24N2O4S and a molecular weight of 352.46 g/mol. Its IUPAC name is N-cycloheptyl-N'-(5-methyl-2-methylsulfonylphenyl)oxamide.
| Compound Name | N-cycloheptyl-N'-(5-methyl-2-methylsulfonylphenyl)oxamide |
|---|---|
| PubChem CID | 75461843 |
| Molecular Formula | C17H24N2O4S |
| Molecular Weight | 352.46 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | N-cycloheptyl-N'-(5-methyl-2-methylsulfonylphenyl)oxamide |
| SMILES | Cc1ccc(S(C)(=O)=O)c(NC(=O)C(=O)NC2CCCCCC2)c1 |
| InChI | InChI=1S/C17H24N2O4S/c1-12-9-10-15(24(2,22)23)14(11-12)19-17(21)16(20)18-13-7-5-3-4-6-8-13/h9-11,13H,3-8H2,1-2H3,(H,18,20)(H,19,21) |
| InChIKey | DNEWKTAVBFDNRW-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.46 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|