C17H14N2O4S — CID 75461935
N-(2-methylsulfonylphenyl)-4-(1,3-oxazol-5-yl)benzamide (PubChem CID 75461935) has the molecular formula C17H14N2O4S and a molecular weight of 342.38 g/mol. Its IUPAC name is N-(2-methylsulfonylphenyl)-4-(1,3-oxazol-5-yl)benzamide.
| Compound Name | N-(2-methylsulfonylphenyl)-4-(1,3-oxazol-5-yl)benzamide |
|---|---|
| PubChem CID | 75461935 |
| Molecular Formula | C17H14N2O4S |
| Molecular Weight | 342.38 g/mol |
| Exact Mass | 342.07 |
| IUPAC Name | N-(2-methylsulfonylphenyl)-4-(1,3-oxazol-5-yl)benzamide |
| SMILES | CS(=O)(=O)c1ccccc1NC(=O)c1ccc(-c2cnco2)cc1 |
| InChI | InChI=1S/C17H14N2O4S/c1-24(21,22)16-5-3-2-4-14(16)19-17(20)13-8-6-12(7-9-13)15-10-18-11-23-15/h2-11H,1H3,(H,19,20) |
| InChIKey | ILYGFYMMDNUSKW-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.38 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |