C22H24N2O3 — CID 75463765
N-[4-(2,5-dioxopyrrolidin-1-yl)-3-methylphenyl]-2-methyl-2-(4-methylphenyl)propanamide (PubChem CID 75463765) has the molecular formula C22H24N2O3 and a molecular weight of 364.44 g/mol. Its IUPAC name is N-[4-(2,5-dioxopyrrolidin-1-yl)-3-methylphenyl]-2-methyl-2-(4-methylphenyl)propanamide.
| Compound Name | N-[4-(2,5-dioxopyrrolidin-1-yl)-3-methylphenyl]-2-methyl-2-(4-methylphenyl)propanamide |
|---|---|
| PubChem CID | 75463765 |
| Molecular Formula | C22H24N2O3 |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | N-[4-(2,5-dioxopyrrolidin-1-yl)-3-methylphenyl]-2-methyl-2-(4-methylphenyl)propanamide |
| SMILES | Cc1ccc(C(C)(C)C(=O)Nc2ccc(N3C(=O)CCC3=O)c(C)c2)cc1 |
| InChI | InChI=1S/C22H24N2O3/c1-14-5-7-16(8-6-14)22(3,4)21(27)23-17-9-10-18(15(2)13-17)24-19(25)11-12-20(24)26/h5-10,13H,11-12H2,1-4H3,(H,23,27) |
| InChIKey | VQGODXJJXXWXJT-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|