C25H28N2O3 — CID 86941652
1-(4-tert-butylphenyl)-N-[4-(2,5-dioxopyrrolidin-1-yl)-3-methylphenyl]cyclopropane-1-carboxamide (PubChem CID 86941652) has the molecular formula C25H28N2O3 and a molecular weight of 404.51 g/mol. Its IUPAC name is 1-(4-tert-butylphenyl)-N-[4-(2,5-dioxopyrrolidin-1-yl)-3-methylphenyl]cyclopropane-1-carboxamide.
| Compound Name | 1-(4-tert-butylphenyl)-N-[4-(2,5-dioxopyrrolidin-1-yl)-3-methylphenyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 86941652 |
| Molecular Formula | C25H28N2O3 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.21 |
| IUPAC Name | 1-(4-tert-butylphenyl)-N-[4-(2,5-dioxopyrrolidin-1-yl)-3-methylphenyl]cyclopropane-1-carboxamide |
| SMILES | Cc1cc(NC(=O)C2(c3ccc(C(C)(C)C)cc3)CC2)ccc1N1C(=O)CCC1=O |
| InChI | InChI=1S/C25H28N2O3/c1-16-15-19(9-10-20(16)27-21(28)11-12-22(27)29)26-23(30)25(13-14-25)18-7-5-17(6-8-18)24(2,3)4/h5-10,15H,11-14H2,1-4H3,(H,26,30) |
| InChIKey | UHTWKLKKTLTDNS-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|