C15H15N5OS — CID 75469836
6-[2-(1,3-benzothiazol-2-yl)propylamino]pyrazine-2-carboxamide (PubChem CID 75469836) has the molecular formula C15H15N5OS and a molecular weight of 313.39 g/mol. Its IUPAC name is 6-[2-(1,3-benzothiazol-2-yl)propylamino]pyrazine-2-carboxamide.
| Compound Name | 6-[2-(1,3-benzothiazol-2-yl)propylamino]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 75469836 |
| Molecular Formula | C15H15N5OS |
| Molecular Weight | 313.39 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | 6-[2-(1,3-benzothiazol-2-yl)propylamino]pyrazine-2-carboxamide |
| SMILES | CC(CNc1cncc(C(N)=O)n1)c1nc2ccccc2s1 |
| InChI | InChI=1S/C15H15N5OS/c1-9(15-20-10-4-2-3-5-12(10)22-15)6-18-13-8-17-7-11(19-13)14(16)21/h2-5,7-9H,6H2,1H3,(H2,16,21)(H,18,19) |
| InChIKey | CEEYBKQANPWLOR-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 93.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.39 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |