C18H25N5O — CID 75480276
3-methyl-N-[(4-morpholin-4-ylphenyl)methyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-amine (PubChem CID 75480276) has the molecular formula C18H25N5O and a molecular weight of 327.43 g/mol. Its IUPAC name is 3-methyl-N-[(4-morpholin-4-ylphenyl)methyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-amine.
| Compound Name | 3-methyl-N-[(4-morpholin-4-ylphenyl)methyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-amine |
|---|---|
| PubChem CID | 75480276 |
| Molecular Formula | C18H25N5O |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.21 |
| IUPAC Name | 3-methyl-N-[(4-morpholin-4-ylphenyl)methyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-amine |
| SMILES | Cc1nnc2n1CC(NCc1ccc(N3CCOCC3)cc1)CC2 |
| InChI | InChI=1S/C18H25N5O/c1-14-20-21-18-7-4-16(13-23(14)18)19-12-15-2-5-17(6-3-15)22-8-10-24-11-9-22/h2-3,5-6,16,19H,4,7-13H2,1H3 |
| InChIKey | UYMKNUSGNOYDJX-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 55.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|