C17H23N5O3 — CID 95156971
N-[(6S)-3-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl]-3-(morpholin-4-ylmethyl)furan-2-carboxamide (PubChem CID 95156971) has the molecular formula C17H23N5O3 and a molecular weight of 345.40 g/mol. Its IUPAC name is N-[(6S)-3-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl]-3-(morpholin-4-ylmethyl)furan-2-carboxamide.
| Compound Name | N-[(6S)-3-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl]-3-(morpholin-4-ylmethyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 95156971 |
| Molecular Formula | C17H23N5O3 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.18 |
| IUPAC Name | N-[(6S)-3-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl]-3-(morpholin-4-ylmethyl)furan-2-carboxamide |
| SMILES | Cc1nnc2n1C[C@@H](NC(=O)c1occc1CN1CCOCC1)CC2 |
| InChI | InChI=1S/C17H23N5O3/c1-12-19-20-15-3-2-14(11-22(12)15)18-17(23)16-13(4-7-25-16)10-21-5-8-24-9-6-21/h4,7,14H,2-3,5-6,8-11H2,1H3,(H,18,23)/t14-/m0/s1 |
| InChIKey | BSZWMUBHSXPYIM-AWEZNQCLSA-N |
| XLogP | 0.76 |
| TPSA | 85.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |