C8H10Cl2N2 — CID 75480947
2,3-dichloro-5,6-diethylpyrazine (PubChem CID 75480947) has the molecular formula C8H10Cl2N2 and a molecular weight of 205.09 g/mol. Its IUPAC name is 2,3-dichloro-5,6-diethylpyrazine.
| Compound Name | 2,3-dichloro-5,6-diethylpyrazine |
|---|---|
| PubChem CID | 75480947 |
| Molecular Formula | C8H10Cl2N2 |
| Molecular Weight | 205.09 g/mol |
| Exact Mass | 204.02 |
| IUPAC Name | 2,3-dichloro-5,6-diethylpyrazine |
| SMILES | CCc1nc(Cl)c(Cl)nc1CC |
| InChI | InChI=1S/C8H10Cl2N2/c1-3-5-6(4-2)12-8(10)7(9)11-5/h3-4H2,1-2H3 |
| InChIKey | IGPMBOSVPGVGPA-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.09 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |