C19H35IN6 — CID 75494809
1-[1-(cyclopropylmethyl)pyrrolidin-3-yl]-3-ethyl-2-[2-(1,3,5-trimethylpyrazol-4-yl)ethyl]guanidine;hydroiodide (PubChem CID 75494809) has the molecular formula C19H35IN6 and a molecular weight of 474.44 g/mol. Its IUPAC name is 1-[1-(cyclopropylmethyl)pyrrolidin-3-yl]-3-ethyl-2-[2-(1,3,5-trimethylpyrazol-4-yl)ethyl]guanidine;hydroiodide.
| Compound Name | 1-[1-(cyclopropylmethyl)pyrrolidin-3-yl]-3-ethyl-2-[2-(1,3,5-trimethylpyrazol-4-yl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 75494809 |
| Molecular Formula | C19H35IN6 |
| Molecular Weight | 474.44 g/mol |
| Exact Mass | 474.20 |
| IUPAC Name | 1-[1-(cyclopropylmethyl)pyrrolidin-3-yl]-3-ethyl-2-[2-(1,3,5-trimethylpyrazol-4-yl)ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCc1c(C)nn(C)c1C)NC1CCN(CC2CC2)C1.I |
| InChI | InChI=1S/C19H34N6.HI/c1-5-20-19(21-10-8-18-14(2)23-24(4)15(18)3)22-17-9-11-25(13-17)12-16-6-7-16;/h16-17H,5-13H2,1-4H3,(H2,20,21,22);1H |
| InChIKey | UUVTWXORIRZFLO-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 57.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.44 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|