C17H28N2O3 — CID 75502666
methyl 1-[3-(cyclohex-2-en-1-ylamino)butanoyl]piperidine-4-carboxylate (PubChem CID 75502666) has the molecular formula C17H28N2O3 and a molecular weight of 308.42 g/mol. Its IUPAC name is methyl 1-[3-(cyclohex-2-en-1-ylamino)butanoyl]piperidine-4-carboxylate.
| Compound Name | methyl 1-[3-(cyclohex-2-en-1-ylamino)butanoyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 75502666 |
| Molecular Formula | C17H28N2O3 |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.21 |
| IUPAC Name | methyl 1-[3-(cyclohex-2-en-1-ylamino)butanoyl]piperidine-4-carboxylate |
| SMILES | COC(=O)C1CCN(C(=O)CC(C)NC2C=CCCC2)CC1 |
| InChI | InChI=1S/C17H28N2O3/c1-13(18-15-6-4-3-5-7-15)12-16(20)19-10-8-14(9-11-19)17(21)22-2/h4,6,13-15,18H,3,5,7-12H2,1-2H3 |
| InChIKey | GOPGOSBAJNVMMT-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|