C20H22ClN5O2 — CID 7550497
(2S)-2-(6-chlorobenzotriazol-1-yl)oxy-N-(4-piperidin-1-ylphenyl)propanamide (PubChem CID 7550497) has the molecular formula C20H22ClN5O2 and a molecular weight of 399.88 g/mol. Its IUPAC name is (2S)-2-(6-chlorobenzotriazol-1-yl)oxy-N-(4-piperidin-1-ylphenyl)propanamide.
| Compound Name | (2S)-2-(6-chlorobenzotriazol-1-yl)oxy-N-(4-piperidin-1-ylphenyl)propanamide |
|---|---|
| PubChem CID | 7550497 |
| Molecular Formula | C20H22ClN5O2 |
| Molecular Weight | 399.88 g/mol |
| Exact Mass | 399.15 |
| IUPAC Name | (2S)-2-(6-chlorobenzotriazol-1-yl)oxy-N-(4-piperidin-1-ylphenyl)propanamide |
| SMILES | C[C@H](On1nnc2ccc(Cl)cc21)C(=O)Nc1ccc(N2CCCCC2)cc1 |
| InChI | InChI=1S/C20H22ClN5O2/c1-14(28-26-19-13-15(21)5-10-18(19)23-24-26)20(27)22-16-6-8-17(9-7-16)25-11-3-2-4-12-25/h5-10,13-14H,2-4,11-12H2,1H3,(H,22,27)/t14-/m0/s1 |
| InChIKey | FZCSLHKCTOWCEV-AWEZNQCLSA-N |
| XLogP | 3.53 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.88 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|