C17H18N4O2S — CID 75505095
1-(8-methoxyquinolin-5-yl)-3-[2-(1,3-thiazol-2-yl)propyl]urea (PubChem CID 75505095) has the molecular formula C17H18N4O2S and a molecular weight of 342.42 g/mol. Its IUPAC name is 1-(8-methoxyquinolin-5-yl)-3-[2-(1,3-thiazol-2-yl)propyl]urea.
| Compound Name | 1-(8-methoxyquinolin-5-yl)-3-[2-(1,3-thiazol-2-yl)propyl]urea |
|---|---|
| PubChem CID | 75505095 |
| Molecular Formula | C17H18N4O2S |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | 1-(8-methoxyquinolin-5-yl)-3-[2-(1,3-thiazol-2-yl)propyl]urea |
| SMILES | COc1ccc(NC(=O)NCC(C)c2nccs2)c2cccnc12 |
| InChI | InChI=1S/C17H18N4O2S/c1-11(16-19-8-9-24-16)10-20-17(22)21-13-5-6-14(23-2)15-12(13)4-3-7-18-15/h3-9,11H,10H2,1-2H3,(H2,20,21,22) |
| InChIKey | NOMQUVIXFSBDRE-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |