C17H14FN3O4 — CID 75506103
methyl 5-[[5-(4-fluorophenyl)-3-methylimidazol-4-yl]carbamoyl]furan-3-carboxylate (PubChem CID 75506103) has the molecular formula C17H14FN3O4 and a molecular weight of 343.31 g/mol. Its IUPAC name is methyl 5-[[5-(4-fluorophenyl)-3-methylimidazol-4-yl]carbamoyl]furan-3-carboxylate.
| Compound Name | methyl 5-[[5-(4-fluorophenyl)-3-methylimidazol-4-yl]carbamoyl]furan-3-carboxylate |
|---|---|
| PubChem CID | 75506103 |
| Molecular Formula | C17H14FN3O4 |
| Molecular Weight | 343.31 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | methyl 5-[[5-(4-fluorophenyl)-3-methylimidazol-4-yl]carbamoyl]furan-3-carboxylate |
| SMILES | COC(=O)c1coc(C(=O)Nc2c(-c3ccc(F)cc3)ncn2C)c1 |
| InChI | InChI=1S/C17H14FN3O4/c1-21-9-19-14(10-3-5-12(18)6-4-10)15(21)20-16(22)13-7-11(8-25-13)17(23)24-2/h3-9H,1-2H3,(H,20,22) |
| InChIKey | LWZAKASVCLLZSV-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 86.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.31 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |