C15H14F3N3O — CID 75508016
1-methyl-3-(6-methyl-2-pyridinyl)-1-[(3,4,5-trifluorophenyl)methyl]urea (PubChem CID 75508016) has the molecular formula C15H14F3N3O and a molecular weight of 309.29 g/mol. Its IUPAC name is 1-methyl-3-(6-methyl-2-pyridinyl)-1-[(3,4,5-trifluorophenyl)methyl]urea.
| Compound Name | 1-methyl-3-(6-methyl-2-pyridinyl)-1-[(3,4,5-trifluorophenyl)methyl]urea |
|---|---|
| PubChem CID | 75508016 |
| Molecular Formula | C15H14F3N3O |
| Molecular Weight | 309.29 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | 1-methyl-3-(6-methyl-2-pyridinyl)-1-[(3,4,5-trifluorophenyl)methyl]urea |
| SMILES | Cc1cccc(NC(=O)N(C)Cc2cc(F)c(F)c(F)c2)n1 |
| InChI | InChI=1S/C15H14F3N3O/c1-9-4-3-5-13(19-9)20-15(22)21(2)8-10-6-11(16)14(18)12(17)7-10/h3-7H,8H2,1-2H3,(H,19,20,22) |
| InChIKey | OSCGBMWLQBARJQ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.29 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|