C14H14ClN5O3 — CID 75509471
(3-chloro-4-nitrophenyl)-[4-(1H-1,2,4-triazol-5-yl)piperidin-1-yl]methanone (PubChem CID 75509471) has the molecular formula C14H14ClN5O3 and a molecular weight of 335.75 g/mol. Its IUPAC name is (3-chloro-4-nitrophenyl)-[4-(1H-1,2,4-triazol-5-yl)piperidin-1-yl]methanone.
| Compound Name | (3-chloro-4-nitrophenyl)-[4-(1H-1,2,4-triazol-5-yl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 75509471 |
| Molecular Formula | C14H14ClN5O3 |
| Molecular Weight | 335.75 g/mol |
| Exact Mass | 335.08 |
| IUPAC Name | (3-chloro-4-nitrophenyl)-[4-(1H-1,2,4-triazol-5-yl)piperidin-1-yl]methanone |
| SMILES | O=C(c1ccc([N+](=O)[O-])c(Cl)c1)N1CCC(c2ncn[nH]2)CC1 |
| InChI | InChI=1S/C14H14ClN5O3/c15-11-7-10(1-2-12(11)20(22)23)14(21)19-5-3-9(4-6-19)13-16-8-17-18-13/h1-2,7-9H,3-6H2,(H,16,17,18) |
| InChIKey | ZSALSWLZKHKDTC-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 105.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.75 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|