C17H20IN3O — CID 75513682
[4-(aminomethyl)piperidin-1-yl]-[1-(3-iodophenyl)pyrrol-2-yl]methanone (PubChem CID 75513682) has the molecular formula C17H20IN3O and a molecular weight of 409.27 g/mol. Its IUPAC name is [4-(aminomethyl)piperidin-1-yl]-[1-(3-iodophenyl)pyrrol-2-yl]methanone.
| Compound Name | [4-(aminomethyl)piperidin-1-yl]-[1-(3-iodophenyl)pyrrol-2-yl]methanone |
|---|---|
| PubChem CID | 75513682 |
| Molecular Formula | C17H20IN3O |
| Molecular Weight | 409.27 g/mol |
| Exact Mass | 409.07 |
| IUPAC Name | [4-(aminomethyl)piperidin-1-yl]-[1-(3-iodophenyl)pyrrol-2-yl]methanone |
| SMILES | NCC1CCN(C(=O)c2cccn2-c2cccc(I)c2)CC1 |
| InChI | InChI=1S/C17H20IN3O/c18-14-3-1-4-15(11-14)21-8-2-5-16(21)17(22)20-9-6-13(12-19)7-10-20/h1-5,8,11,13H,6-7,9-10,12,19H2 |
| InChIKey | RLCFGPTXTHAQFS-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 51.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.27 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|