C18H18IN5O — CID 86905735
[1-(3-iodophenyl)pyrrol-2-yl]-[3-(1,2,4-triazol-1-yl)piperidin-1-yl]methanone (PubChem CID 86905735) has the molecular formula C18H18IN5O and a molecular weight of 447.28 g/mol. Its IUPAC name is [1-(3-iodophenyl)pyrrol-2-yl]-[3-(1,2,4-triazol-1-yl)piperidin-1-yl]methanone.
| Compound Name | [1-(3-iodophenyl)pyrrol-2-yl]-[3-(1,2,4-triazol-1-yl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 86905735 |
| Molecular Formula | C18H18IN5O |
| Molecular Weight | 447.28 g/mol |
| Exact Mass | 447.06 |
| IUPAC Name | [1-(3-iodophenyl)pyrrol-2-yl]-[3-(1,2,4-triazol-1-yl)piperidin-1-yl]methanone |
| SMILES | O=C(c1cccn1-c1cccc(I)c1)N1CCCC(n2cncn2)C1 |
| InChI | InChI=1S/C18H18IN5O/c19-14-4-1-5-15(10-14)23-9-3-7-17(23)18(25)22-8-2-6-16(11-22)24-13-20-12-21-24/h1,3-5,7,9-10,12-13,16H,2,6,8,11H2 |
| InChIKey | MKGIJYGOUNCRIQ-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 55.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.28 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|