C19H19IN4O — CID 86881866
[1-(3-iodophenyl)pyrrol-2-yl]-(3-pyrazol-1-ylpiperidin-1-yl)methanone (PubChem CID 86881866) has the molecular formula C19H19IN4O and a molecular weight of 446.29 g/mol. Its IUPAC name is [1-(3-iodophenyl)pyrrol-2-yl]-(3-pyrazol-1-ylpiperidin-1-yl)methanone.
| Compound Name | [1-(3-iodophenyl)pyrrol-2-yl]-(3-pyrazol-1-ylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 86881866 |
| Molecular Formula | C19H19IN4O |
| Molecular Weight | 446.29 g/mol |
| Exact Mass | 446.06 |
| IUPAC Name | [1-(3-iodophenyl)pyrrol-2-yl]-(3-pyrazol-1-ylpiperidin-1-yl)methanone |
| SMILES | O=C(c1cccn1-c1cccc(I)c1)N1CCCC(n2cccn2)C1 |
| InChI | InChI=1S/C19H19IN4O/c20-15-5-1-6-16(13-15)23-11-3-8-18(23)19(25)22-10-2-7-17(14-22)24-12-4-9-21-24/h1,3-6,8-9,11-13,17H,2,7,10,14H2 |
| InChIKey | DFJRZGZPTUMZJQ-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 43.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.29 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|