C15H14BrN3O2 — CID 75515211
N-(6-bromo-1-ethylbenzimidazol-2-yl)-2-methylfuran-3-carboxamide (PubChem CID 75515211) has the molecular formula C15H14BrN3O2 and a molecular weight of 348.20 g/mol. Its IUPAC name is N-(6-bromo-1-ethylbenzimidazol-2-yl)-2-methylfuran-3-carboxamide.
| Compound Name | N-(6-bromo-1-ethylbenzimidazol-2-yl)-2-methylfuran-3-carboxamide |
|---|---|
| PubChem CID | 75515211 |
| Molecular Formula | C15H14BrN3O2 |
| Molecular Weight | 348.20 g/mol |
| Exact Mass | 347.03 |
| IUPAC Name | N-(6-bromo-1-ethylbenzimidazol-2-yl)-2-methylfuran-3-carboxamide |
| SMILES | CCn1c(NC(=O)c2ccoc2C)nc2ccc(Br)cc21 |
| InChI | InChI=1S/C15H14BrN3O2/c1-3-19-13-8-10(16)4-5-12(13)17-15(19)18-14(20)11-6-7-21-9(11)2/h4-8H,3H2,1-2H3,(H,17,18,20) |
| InChIKey | URGLPXOWPPNAJP-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 60.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.20 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |