C15H21ClN2O3 — CID 75517615
N-(2-chloro-5-methoxyphenyl)-2-(2-hydroxypropan-2-yl)pyrrolidine-1-carboxamide (PubChem CID 75517615) has the molecular formula C15H21ClN2O3 and a molecular weight of 312.80 g/mol. Its IUPAC name is N-(2-chloro-5-methoxyphenyl)-2-(2-hydroxypropan-2-yl)pyrrolidine-1-carboxamide.
| Compound Name | N-(2-chloro-5-methoxyphenyl)-2-(2-hydroxypropan-2-yl)pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 75517615 |
| Molecular Formula | C15H21ClN2O3 |
| Molecular Weight | 312.80 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | N-(2-chloro-5-methoxyphenyl)-2-(2-hydroxypropan-2-yl)pyrrolidine-1-carboxamide |
| SMILES | COc1ccc(Cl)c(NC(=O)N2CCCC2C(C)(C)O)c1 |
| InChI | InChI=1S/C15H21ClN2O3/c1-15(2,20)13-5-4-8-18(13)14(19)17-12-9-10(21-3)6-7-11(12)16/h6-7,9,13,20H,4-5,8H2,1-3H3,(H,17,19) |
| InChIKey | MITNAKNXNCNYIY-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.80 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |