About 3-pyrazol-1-ylpropyl 2-methyl-6-oxo-1H-pyridine-4-carboxylate
3-pyrazol-1-ylpropyl 2-methyl-6-oxo-1H-pyridine-4-carboxylate (PubChem CID 75519742) has the molecular formula C13H15N3O3
and a molecular weight of 261.28 g/mol. Its IUPAC name is 3-pyrazol-1-ylpropyl 2-methyl-6-oxo-1H-pyridine-4-carboxylate.
Molecular Properties
| Compound Name | 3-pyrazol-1-ylpropyl 2-methyl-6-oxo-1H-pyridine-4-carboxylate |
| PubChem CID | 75519742 |
| Molecular Formula | C13H15N3O3 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | 3-pyrazol-1-ylpropyl 2-methyl-6-oxo-1H-pyridine-4-carboxylate |
| SMILES | Cc1cc(C(=O)OCCCn2cccn2)cc(=O)[nH]1 |
| InChI | InChI=1S/C13H15N3O3/c1-10-8-11(9-12(17)15-10)13(18)19-7-3-6-16-5-2-4-14-16/h2,4-5,8-9H,3,6-7H2,1H3,(H,15,17) |
| InChIKey | IFQKMJKEZDRLNF-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 76.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-pyrazol-1-ylpropyl 2-methyl-6-oxo-1H-pyridine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-pyrazol-1-ylpropyl 2-methyl-6-oxo-1H-pyridine-4-carboxylate?
The IUPAC name of 3-pyrazol-1-ylpropyl 2-methyl-6-oxo-1H-pyridine-4-carboxylate (CID 75519742) is 3-pyrazol-1-ylpropyl 2-methyl-6-oxo-1H-pyridine-4-carboxylate.
What is the SMILES notation for 3-pyrazol-1-ylpropyl 2-methyl-6-oxo-1H-pyridine-4-carboxylate?
The canonical SMILES for 3-pyrazol-1-ylpropyl 2-methyl-6-oxo-1H-pyridine-4-carboxylate is Cc1cc(C(=O)OCCCn2cccn2)cc(=O)[nH]1.
What is the InChIKey of 3-pyrazol-1-ylpropyl 2-methyl-6-oxo-1H-pyridine-4-carboxylate?
The InChIKey is IFQKMJKEZDRLNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15N3O3/c1-10-8-11(9-12(17)15-10)13(18)19-7-3-6-16-5-2-4-14-16/h2,4-5,8-9H,3,6-7H2,1H3,(H,15,17).
What are the key properties of 3-pyrazol-1-ylpropyl 2-methyl-6-oxo-1H-pyridine-4-carboxylate?
3-pyrazol-1-ylpropyl 2-methyl-6-oxo-1H-pyridine-4-carboxylate has a molecular weight of 261.28 g/mol, XLogP of 1.13, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-pyrazol-1-ylpropyl 2-methyl-6-oxo-1H-pyridine-4-carboxylate is sourced from PubChem (CID 75519742), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).