C16H15F2N3O2 — CID 75519939
5,6-difluoro-1-[[2-(2-methoxyethoxy)-4-pyridinyl]methyl]benzimidazole (PubChem CID 75519939) has the molecular formula C16H15F2N3O2 and a molecular weight of 319.31 g/mol. Its IUPAC name is 5,6-difluoro-1-[[2-(2-methoxyethoxy)-4-pyridinyl]methyl]benzimidazole.
| Compound Name | 5,6-difluoro-1-[[2-(2-methoxyethoxy)-4-pyridinyl]methyl]benzimidazole |
|---|---|
| PubChem CID | 75519939 |
| Molecular Formula | C16H15F2N3O2 |
| Molecular Weight | 319.31 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | 5,6-difluoro-1-[[2-(2-methoxyethoxy)-4-pyridinyl]methyl]benzimidazole |
| SMILES | COCCOc1cc(Cn2cnc3cc(F)c(F)cc32)ccn1 |
| InChI | InChI=1S/C16H15F2N3O2/c1-22-4-5-23-16-6-11(2-3-19-16)9-21-10-20-14-7-12(17)13(18)8-15(14)21/h2-3,6-8,10H,4-5,9H2,1H3 |
| InChIKey | CCQVSVQCJPAJME-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.31 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|