C17H24N2O3 — CID 75522944
propan-2-yl 2-(2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-6-yl)pyridine-3-carboxylate (PubChem CID 75522944) has the molecular formula C17H24N2O3 and a molecular weight of 304.39 g/mol. Its IUPAC name is propan-2-yl 2-(2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-6-yl)pyridine-3-carboxylate.
| Compound Name | propan-2-yl 2-(2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-6-yl)pyridine-3-carboxylate |
|---|---|
| PubChem CID | 75522944 |
| Molecular Formula | C17H24N2O3 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | propan-2-yl 2-(2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-6-yl)pyridine-3-carboxylate |
| SMILES | CC(C)OC(=O)c1cccnc1N1CCC2OCCCC2C1 |
| InChI | InChI=1S/C17H24N2O3/c1-12(2)22-17(20)14-6-3-8-18-16(14)19-9-7-15-13(11-19)5-4-10-21-15/h3,6,8,12-13,15H,4-5,7,9-11H2,1-2H3 |
| InChIKey | XUCGCYAIKDWRHE-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |