C22H29N3O2 — CID 67323448
propan-2-yl 2-[(3S)-3-[(4-ethylphenyl)methylamino]pyrrolidin-1-yl]pyridine-3-carboxylate (PubChem CID 67323448) has the molecular formula C22H29N3O2 and a molecular weight of 367.49 g/mol. Its IUPAC name is propan-2-yl 2-[(3S)-3-[(4-ethylphenyl)methylamino]pyrrolidin-1-yl]pyridine-3-carboxylate.
| Compound Name | propan-2-yl 2-[(3S)-3-[(4-ethylphenyl)methylamino]pyrrolidin-1-yl]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 67323448 |
| Molecular Formula | C22H29N3O2 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.23 |
| IUPAC Name | propan-2-yl 2-[(3S)-3-[(4-ethylphenyl)methylamino]pyrrolidin-1-yl]pyridine-3-carboxylate |
| SMILES | CCc1ccc(CN[C@H]2CCN(c3ncccc3C(=O)OC(C)C)C2)cc1 |
| InChI | InChI=1S/C22H29N3O2/c1-4-17-7-9-18(10-8-17)14-24-19-11-13-25(15-19)21-20(6-5-12-23-21)22(26)27-16(2)3/h5-10,12,16,19,24H,4,11,13-15H2,1-3H3/t19-/m0/s1 |
| InChIKey | PDYFSPRTNZOWSS-IBGZPJMESA-N |
| XLogP | 3.58 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |