C21H29AsN2O2S — CID 87376536
propan-2-yl 2-[3-[(5-ethylthiophen-2-yl)methyl-methylarsanyl]pyrrolidin-1-yl]pyridine-3-carboxylate (PubChem CID 87376536) has the molecular formula C21H29AsN2O2S and a molecular weight of 448.46 g/mol. Its IUPAC name is propan-2-yl 2-[3-[(5-ethylthiophen-2-yl)methyl-methylarsanyl]pyrrolidin-1-yl]pyridine-3-carboxylate.
| Compound Name | propan-2-yl 2-[3-[(5-ethylthiophen-2-yl)methyl-methylarsanyl]pyrrolidin-1-yl]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 87376536 |
| Molecular Formula | C21H29AsN2O2S |
| Molecular Weight | 448.46 g/mol |
| Exact Mass | 448.12 |
| IUPAC Name | propan-2-yl 2-[3-[(5-ethylthiophen-2-yl)methyl-methylarsanyl]pyrrolidin-1-yl]pyridine-3-carboxylate |
| SMILES | CCc1ccc(C[As](C)C2CCN(c3ncccc3C(=O)OC(C)C)C2)s1 |
| InChI | InChI=1S/C21H29AsN2O2S/c1-5-17-8-9-18(27-17)13-22(4)16-10-12-24(14-16)20-19(7-6-11-23-20)21(25)26-15(2)3/h6-9,11,15-16H,5,10,12-14H2,1-4H3 |
| InChIKey | UFMDVBWGLMZMBK-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.46 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|