C15H14BrF2N3O2 — CID 75524301
6-[[3-bromo-4-(difluoromethoxy)phenyl]methylamino]-N-methylpyridine-2-carboxamide (PubChem CID 75524301) has the molecular formula C15H14BrF2N3O2 and a molecular weight of 386.20 g/mol. Its IUPAC name is 6-[[3-bromo-4-(difluoromethoxy)phenyl]methylamino]-N-methylpyridine-2-carboxamide.
| Compound Name | 6-[[3-bromo-4-(difluoromethoxy)phenyl]methylamino]-N-methylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 75524301 |
| Molecular Formula | C15H14BrF2N3O2 |
| Molecular Weight | 386.20 g/mol |
| Exact Mass | 385.02 |
| IUPAC Name | 6-[[3-bromo-4-(difluoromethoxy)phenyl]methylamino]-N-methylpyridine-2-carboxamide |
| SMILES | CNC(=O)c1cccc(NCc2ccc(OC(F)F)c(Br)c2)n1 |
| InChI | InChI=1S/C15H14BrF2N3O2/c1-19-14(22)11-3-2-4-13(21-11)20-8-9-5-6-12(10(16)7-9)23-15(17)18/h2-7,15H,8H2,1H3,(H,19,22)(H,20,21) |
| InChIKey | WGTQQPSUZMSUTP-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.20 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |